C14H18N6O2 — CID 56737308
1-ethyl-4-[2-nitro-4-(1,2,4-triazol-4-yl)phenyl]piperazine (PubChem CID 56737308) has the molecular formula C14H18N6O2 and a molecular weight of 302.34 g/mol. Its IUPAC name is 1-ethyl-4-[2-nitro-4-(1,2,4-triazol-4-yl)phenyl]piperazine.
| Compound Name | 1-ethyl-4-[2-nitro-4-(1,2,4-triazol-4-yl)phenyl]piperazine |
|---|---|
| PubChem CID | 56737308 |
| Molecular Formula | C14H18N6O2 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 1-ethyl-4-[2-nitro-4-(1,2,4-triazol-4-yl)phenyl]piperazine |
| SMILES | CCN1CCN(c2ccc(-n3cnnc3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C14H18N6O2/c1-2-17-5-7-18(8-6-17)13-4-3-12(9-14(13)20(21)22)19-10-15-16-11-19/h3-4,9-11H,2,5-8H2,1H3 |
| InChIKey | JJNYKHOBNQHLRB-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 80.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|