C22H34N4O6 — CID 141498164
tert-butyl N-[4-(4-ethylpiperazin-1-yl)-2-nitrophenyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (PubChem CID 141498164) has the molecular formula C22H34N4O6 and a molecular weight of 450.54 g/mol. Its IUPAC name is tert-butyl N-[4-(4-ethylpiperazin-1-yl)-2-nitrophenyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
| Compound Name | tert-butyl N-[4-(4-ethylpiperazin-1-yl)-2-nitrophenyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
|---|---|
| PubChem CID | 141498164 |
| Molecular Formula | C22H34N4O6 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | tert-butyl N-[4-(4-ethylpiperazin-1-yl)-2-nitrophenyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| SMILES | CCN1CCN(c2ccc(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C22H34N4O6/c1-8-23-11-13-24(14-12-23)16-9-10-17(18(15-16)26(29)30)25(19(27)31-21(2,3)4)20(28)32-22(5,6)7/h9-10,15H,8,11-14H2,1-7H3 |
| InChIKey | CIWRAHIUSQWJLQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 105.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|