C23H25F3N2O6 — CID 168792242
tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[2-nitro-4-[4-(trifluoromethyl)phenyl]phenyl]carbamate (PubChem CID 168792242) has the molecular formula C23H25F3N2O6 and a molecular weight of 482.46 g/mol. Its IUPAC name is tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[2-nitro-4-[4-(trifluoromethyl)phenyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[2-nitro-4-[4-(trifluoromethyl)phenyl]phenyl]carbamate |
|---|---|
| PubChem CID | 168792242 |
| Molecular Formula | C23H25F3N2O6 |
| Molecular Weight | 482.46 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[2-nitro-4-[4-(trifluoromethyl)phenyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)c1ccc(-c2ccc(C(F)(F)F)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H25F3N2O6/c1-21(2,3)33-19(29)27(20(30)34-22(4,5)6)17-12-9-15(13-18(17)28(31)32)14-7-10-16(11-8-14)23(24,25)26/h7-13H,1-6H3 |
| InChIKey | BJMFJTMATVGTPD-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.46 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|