C19H23FN4O6 — CID 175863139
tert-butyl N-[5-(4-fluoro-3-nitrophenyl)-1H-imidazol-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (PubChem CID 175863139) has the molecular formula C19H23FN4O6 and a molecular weight of 422.41 g/mol. Its IUPAC name is tert-butyl N-[5-(4-fluoro-3-nitrophenyl)-1H-imidazol-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
| Compound Name | tert-butyl N-[5-(4-fluoro-3-nitrophenyl)-1H-imidazol-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
|---|---|
| PubChem CID | 175863139 |
| Molecular Formula | C19H23FN4O6 |
| Molecular Weight | 422.41 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | tert-butyl N-[5-(4-fluoro-3-nitrophenyl)-1H-imidazol-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)c1ncc(-c2ccc(F)c([N+](=O)[O-])c2)[nH]1 |
| InChI | InChI=1S/C19H23FN4O6/c1-18(2,3)29-16(25)23(17(26)30-19(4,5)6)15-21-10-13(22-15)11-7-8-12(20)14(9-11)24(27)28/h7-10H,1-6H3,(H,21,22) |
| InChIKey | LKLRAIZBJDMEIA-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 127.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.41 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|