C20H24N4O6 — CID 168792520
tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-(2-nitro-4-pyrimidin-5-ylphenyl)carbamate (PubChem CID 168792520) has the molecular formula C20H24N4O6 and a molecular weight of 416.43 g/mol. Its IUPAC name is tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-(2-nitro-4-pyrimidin-5-ylphenyl)carbamate.
| Compound Name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-(2-nitro-4-pyrimidin-5-ylphenyl)carbamate |
|---|---|
| PubChem CID | 168792520 |
| Molecular Formula | C20H24N4O6 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-(2-nitro-4-pyrimidin-5-ylphenyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)c1ccc(-c2cncnc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H24N4O6/c1-19(2,3)29-17(25)23(18(26)30-20(4,5)6)15-8-7-13(9-16(15)24(27)28)14-10-21-12-22-11-14/h7-12H,1-6H3 |
| InChIKey | FVODACSANPQUFL-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 124.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|