C25H37N3O9 — CID 154940364
tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[4-[[1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropyl]methoxy]-2-nitrophenyl]carbamate (PubChem CID 154940364) has the molecular formula C25H37N3O9 and a molecular weight of 523.58 g/mol. Its IUPAC name is tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[4-[[1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropyl]methoxy]-2-nitrophenyl]carbamate.
| Compound Name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[4-[[1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropyl]methoxy]-2-nitrophenyl]carbamate |
|---|---|
| PubChem CID | 154940364 |
| Molecular Formula | C25H37N3O9 |
| Molecular Weight | 523.58 g/mol |
| Exact Mass | 523.25 |
| IUPAC Name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[4-[[1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropyl]methoxy]-2-nitrophenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(COc2ccc(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C25H37N3O9/c1-22(2,3)35-19(29)26-25(12-13-25)15-34-16-10-11-17(18(14-16)28(32)33)27(20(30)36-23(4,5)6)21(31)37-24(7,8)9/h10-11,14H,12-13,15H2,1-9H3,(H,26,29) |
| InChIKey | KQGHUKSWXMUVJE-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 146.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.58 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|