C31H42N4O9 — CID 11614211
tert-butyl 7-[2-[4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-nitrophenoxy]ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate (PubChem CID 11614211) has the molecular formula C31H42N4O9 and a molecular weight of 614.70 g/mol. Its IUPAC name is tert-butyl 7-[2-[4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-nitrophenoxy]ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate.
| Compound Name | tert-butyl 7-[2-[4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-nitrophenoxy]ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate |
|---|---|
| PubChem CID | 11614211 |
| Molecular Formula | C31H42N4O9 |
| Molecular Weight | 614.70 g/mol |
| Exact Mass | 614.30 |
| IUPAC Name | tert-butyl 7-[2-[4-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-nitrophenoxy]ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCc2ccc(CCOc3ccc(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)c([N+](=O)[O-])c3)nc21 |
| InChI | InChI=1S/C31H42N4O9/c1-29(2,3)42-26(36)33-17-10-11-20-12-13-21(32-25(20)33)16-18-41-22-14-15-23(24(19-22)35(39)40)34(27(37)43-30(4,5)6)28(38)44-31(7,8)9/h12-15,19H,10-11,16-18H2,1-9H3 |
| InChIKey | PWZFAXZOVVFIMV-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 150.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.70 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|