About tert-butyl 7-[2-(3-formyl-4-nitrophenoxy)ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate
tert-butyl 7-[2-(3-formyl-4-nitrophenoxy)ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate (PubChem CID 142348403) has the molecular formula C22H25N3O6
and a molecular weight of 427.46 g/mol. Its IUPAC name is tert-butyl 7-[2-(3-formyl-4-nitrophenoxy)ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 7-[2-(3-formyl-4-nitrophenoxy)ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate |
| PubChem CID | 142348403 |
| Molecular Formula | C22H25N3O6 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | tert-butyl 7-[2-(3-formyl-4-nitrophenoxy)ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCc2ccc(CCOc3ccc([N+](=O)[O-])c(C=O)c3)nc21 |
| InChI | InChI=1S/C22H25N3O6/c1-22(2,3)31-21(27)24-11-4-5-15-6-7-17(23-20(15)24)10-12-30-18-8-9-19(25(28)29)16(13-18)14-26/h6-9,13-14H,4-5,10-12H2,1-3H3 |
| InChIKey | ILOQCGAVEADRDF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 111.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 7-[2-(3-formyl-4-nitrophenoxy)ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 7-[2-(3-formyl-4-nitrophenoxy)ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate?
The IUPAC name of tert-butyl 7-[2-(3-formyl-4-nitrophenoxy)ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate (CID 142348403) is tert-butyl 7-[2-(3-formyl-4-nitrophenoxy)ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate.
What is the SMILES notation for tert-butyl 7-[2-(3-formyl-4-nitrophenoxy)ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate?
The canonical SMILES for tert-butyl 7-[2-(3-formyl-4-nitrophenoxy)ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate is CC(C)(C)OC(=O)N1CCCc2ccc(CCOc3ccc([N+](=O)[O-])c(C=O)c3)nc21.
What is the InChIKey of tert-butyl 7-[2-(3-formyl-4-nitrophenoxy)ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate?
The InChIKey is ILOQCGAVEADRDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N3O6/c1-22(2,3)31-21(27)24-11-4-5-15-6-7-17(23-20(15)24)10-12-30-18-8-9-19(25(28)29)16(13-18)14-26/h6-9,13-14H,4-5,10-12H2,1-3H3.
What are the key properties of tert-butyl 7-[2-(3-formyl-4-nitrophenoxy)ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate?
tert-butyl 7-[2-(3-formyl-4-nitrophenoxy)ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate has a molecular weight of 427.46 g/mol, XLogP of 4.11, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 7-[2-(3-formyl-4-nitrophenoxy)ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate is sourced from PubChem (CID 142348403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).