C18H25LiN2O4 — CID 168874390
lithium 5-[8-[(2-methylpropan-2-yl)oxycarbonyl]-6,7-dihydro-5H-1,8-naphthyridin-2-yl]pentanoate (PubChem CID 168874390) has the molecular formula C18H25LiN2O4 and a molecular weight of 340.35 g/mol. Its IUPAC name is lithium 5-[8-[(2-methylpropan-2-yl)oxycarbonyl]-6,7-dihydro-5H-1,8-naphthyridin-2-yl]pentanoate.
| Compound Name | lithium 5-[8-[(2-methylpropan-2-yl)oxycarbonyl]-6,7-dihydro-5H-1,8-naphthyridin-2-yl]pentanoate |
|---|---|
| PubChem CID | 168874390 |
| Molecular Formula | C18H25LiN2O4 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | lithium 5-[8-[(2-methylpropan-2-yl)oxycarbonyl]-6,7-dihydro-5H-1,8-naphthyridin-2-yl]pentanoate |
| SMILES | CC(C)(C)OC(=O)N1CCCc2ccc(CCCCC(=O)[O-])nc21.[Li+] |
| InChI | InChI=1S/C18H26N2O4.Li/c1-18(2,3)24-17(23)20-12-6-7-13-10-11-14(19-16(13)20)8-4-5-9-15(21)22;/h10-11H,4-9,12H2,1-3H3,(H,21,22);/q;+1/p-1 |
| InChIKey | SGYZNRAJKDADRA-UHFFFAOYSA-M |
| XLogP | -0.76 |
| TPSA | 82.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|