C22H27IN2O3 — CID 153467939
tert-butyl 7-[2-[(4-iodophenyl)methoxy]ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate (PubChem CID 153467939) has the molecular formula C22H27IN2O3 and a molecular weight of 494.37 g/mol. Its IUPAC name is tert-butyl 7-[2-[(4-iodophenyl)methoxy]ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate.
| Compound Name | tert-butyl 7-[2-[(4-iodophenyl)methoxy]ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate |
|---|---|
| PubChem CID | 153467939 |
| Molecular Formula | C22H27IN2O3 |
| Molecular Weight | 494.37 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | tert-butyl 7-[2-[(4-iodophenyl)methoxy]ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCc2ccc(CCOCc3ccc(I)cc3)nc21 |
| InChI | InChI=1S/C22H27IN2O3/c1-22(2,3)28-21(26)25-13-4-5-17-8-11-19(24-20(17)25)12-14-27-15-16-6-9-18(23)10-7-16/h6-11H,4-5,12-15H2,1-3H3 |
| InChIKey | UJDMDUZGJXGDLO-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.37 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|