C19H28N2O2 — CID 134394630
tert-butyl 7-hex-5-enyl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate (PubChem CID 134394630) has the molecular formula C19H28N2O2 and a molecular weight of 316.45 g/mol. Its IUPAC name is tert-butyl 7-hex-5-enyl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate.
| Compound Name | tert-butyl 7-hex-5-enyl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate |
|---|---|
| PubChem CID | 134394630 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | tert-butyl 7-hex-5-enyl-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate |
| SMILES | C=CCCCCc1ccc2c(n1)N(C(=O)OC(C)(C)C)CCC2 |
| InChI | InChI=1S/C19H28N2O2/c1-5-6-7-8-11-16-13-12-15-10-9-14-21(17(15)20-16)18(22)23-19(2,3)4/h5,12-13H,1,6-11,14H2,2-4H3 |
| InChIKey | AORLVUUXRUKIMS-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|