C52H68N2O4Si2 — CID 142754710
tert-butyl 7-[6-[tert-butyl(diphenyl)silyl]oxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]hexyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate (PubChem CID 142754710) has the molecular formula C52H68N2O4Si2 and a molecular weight of 841.30 g/mol. Its IUPAC name is tert-butyl 7-[6-[tert-butyl(diphenyl)silyl]oxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]hexyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate.
| Compound Name | tert-butyl 7-[6-[tert-butyl(diphenyl)silyl]oxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]hexyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate |
|---|---|
| PubChem CID | 142754710 |
| Molecular Formula | C52H68N2O4Si2 |
| Molecular Weight | 841.30 g/mol |
| Exact Mass | 840.47 |
| IUPAC Name | tert-butyl 7-[6-[tert-butyl(diphenyl)silyl]oxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]hexyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCc2ccc(CCCCC(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)nc21 |
| InChI | InChI=1S/C52H68N2O4Si2/c1-50(2,3)58-49(55)54-38-24-26-42-36-37-43(53-48(42)54)27-23-22-25-41(39-56-59(51(4,5)6,44-28-14-10-15-29-44)45-30-16-11-17-31-45)40-57-60(52(7,8)9,46-32-18-12-19-33-46)47-34-20-13-21-35-47/h10-21,28-37,41H,22-27,38-40H2,1-9H3 |
| InChIKey | NNIOZOQSRIVNGK-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.30 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|