C34H49N5O7 — CID 153429312
tert-butyl 7-[4-[2-acetamidoethyl-[(3R)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butyl]amino]butyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate (PubChem CID 153429312) has the molecular formula C34H49N5O7 and a molecular weight of 639.79 g/mol. Its IUPAC name is tert-butyl 7-[4-[2-acetamidoethyl-[(3R)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butyl]amino]butyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate.
| Compound Name | tert-butyl 7-[4-[2-acetamidoethyl-[(3R)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butyl]amino]butyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate |
|---|---|
| PubChem CID | 153429312 |
| Molecular Formula | C34H49N5O7 |
| Molecular Weight | 639.79 g/mol |
| Exact Mass | 639.36 |
| IUPAC Name | tert-butyl 7-[4-[2-acetamidoethyl-[(3R)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butyl]amino]butyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate |
| SMILES | COC(=O)[C@@H](CCN(CCCCc1ccc2c(n1)N(C(=O)OC(C)(C)C)CCC2)CCNC(C)=O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C34H49N5O7/c1-25(40)35-19-23-38(22-18-29(31(41)44-5)37-32(42)45-24-26-12-7-6-8-13-26)20-10-9-15-28-17-16-27-14-11-21-39(30(27)36-28)33(43)46-34(2,3)4/h6-8,12-13,16-17,29H,9-11,14-15,18-24H2,1-5H3,(H,35,40)(H,37,42)/t29-/m1/s1 |
| InChIKey | YZVMDYXHDGUCEB-GDLZYMKVSA-N |
| XLogP | 4.39 |
| TPSA | 139.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.79 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|