C28H39N5O5 — CID 139463314
4-[2-acetamidoethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(phenylmethoxycarbonylamino)butanoic acid (PubChem CID 139463314) has the molecular formula C28H39N5O5 and a molecular weight of 525.65 g/mol. Its IUPAC name is 4-[2-acetamidoethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(phenylmethoxycarbonylamino)butanoic acid.
| Compound Name | 4-[2-acetamidoethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(phenylmethoxycarbonylamino)butanoic acid |
|---|---|
| PubChem CID | 139463314 |
| Molecular Formula | C28H39N5O5 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.30 |
| IUPAC Name | 4-[2-acetamidoethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(phenylmethoxycarbonylamino)butanoic acid |
| SMILES | CC(=O)NCCN(CCCCc1ccc2c(n1)NCCC2)CCC(NC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C28H39N5O5/c1-21(34)29-16-19-33(17-6-5-11-24-13-12-23-10-7-15-30-26(23)31-24)18-14-25(27(35)36)32-28(37)38-20-22-8-3-2-4-9-22/h2-4,8-9,12-13,25H,5-7,10-11,14-20H2,1H3,(H,29,34)(H,30,31)(H,32,37)(H,35,36) |
| InChIKey | DWWONDWKVCZSDM-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 132.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|