C28H38F2N4O5 — CID 139463549
(2S)-4-[2-(2,2-difluoroethoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(phenylmethoxycarbonylamino)butanoic acid (PubChem CID 139463549) has the molecular formula C28H38F2N4O5 and a molecular weight of 548.63 g/mol. Its IUPAC name is (2S)-4-[2-(2,2-difluoroethoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(phenylmethoxycarbonylamino)butanoic acid.
| Compound Name | (2S)-4-[2-(2,2-difluoroethoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(phenylmethoxycarbonylamino)butanoic acid |
|---|---|
| PubChem CID | 139463549 |
| Molecular Formula | C28H38F2N4O5 |
| Molecular Weight | 548.63 g/mol |
| Exact Mass | 548.28 |
| IUPAC Name | (2S)-4-[2-(2,2-difluoroethoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(phenylmethoxycarbonylamino)butanoic acid |
| SMILES | O=C(N[C@@H](CCN(CCCCc1ccc2c(n1)NCCC2)CCOCC(F)F)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C28H38F2N4O5/c29-25(30)20-38-18-17-34(15-5-4-10-23-12-11-22-9-6-14-31-26(22)32-23)16-13-24(27(35)36)33-28(37)39-19-21-7-2-1-3-8-21/h1-3,7-8,11-12,24-25H,4-6,9-10,13-20H2,(H,31,32)(H,33,37)(H,35,36)/t24-/m0/s1 |
| InChIKey | BSZYEICCZYXWNR-DEOSSOPVSA-N |
| XLogP | 4.12 |
| TPSA | 113.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.63 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|