C25H34BrF2N5O3 — CID 139464211
(2S)-2-[(4-bromo-2-pyridinyl)amino]-4-[2-(2,2-difluoroethoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid (PubChem CID 139464211) has the molecular formula C25H34BrF2N5O3 and a molecular weight of 570.48 g/mol. Its IUPAC name is (2S)-2-[(4-bromo-2-pyridinyl)amino]-4-[2-(2,2-difluoroethoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid.
| Compound Name | (2S)-2-[(4-bromo-2-pyridinyl)amino]-4-[2-(2,2-difluoroethoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
|---|---|
| PubChem CID | 139464211 |
| Molecular Formula | C25H34BrF2N5O3 |
| Molecular Weight | 570.48 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | (2S)-2-[(4-bromo-2-pyridinyl)amino]-4-[2-(2,2-difluoroethoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
| SMILES | O=C(O)[C@H](CCN(CCCCc1ccc2c(n1)NCCC2)CCOCC(F)F)Nc1cc(Br)ccn1 |
| InChI | InChI=1S/C25H34BrF2N5O3/c26-19-8-11-29-23(16-19)32-21(25(34)35)9-13-33(14-15-36-17-22(27)28)12-2-1-5-20-7-6-18-4-3-10-30-24(18)31-20/h6-8,11,16,21-22H,1-5,9-10,12-15,17H2,(H,29,32)(H,30,31)(H,34,35)/t21-/m0/s1 |
| InChIKey | JPNHMAMZCXWDMT-NRFANRHFSA-N |
| XLogP | 4.46 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|