C25H32F6N6O3 — CID 156690278
4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl-[2-(2,2,2-trifluoroethoxy)ethyl]amino]-2-[[2-(trifluoromethyl)pyrimidin-4-yl]amino]butanoic acid (PubChem CID 156690278) has the molecular formula C25H32F6N6O3 and a molecular weight of 578.56 g/mol. Its IUPAC name is 4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl-[2-(2,2,2-trifluoroethoxy)ethyl]amino]-2-[[2-(trifluoromethyl)pyrimidin-4-yl]amino]butanoic acid.
| Compound Name | 4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl-[2-(2,2,2-trifluoroethoxy)ethyl]amino]-2-[[2-(trifluoromethyl)pyrimidin-4-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 156690278 |
| Molecular Formula | C25H32F6N6O3 |
| Molecular Weight | 578.56 g/mol |
| Exact Mass | 578.24 |
| IUPAC Name | 4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl-[2-(2,2,2-trifluoroethoxy)ethyl]amino]-2-[[2-(trifluoromethyl)pyrimidin-4-yl]amino]butanoic acid |
| SMILES | O=C(O)C(CCN(CCCCc1ccc2c(n1)NCCC2)CCOCC(F)(F)F)Nc1ccnc(C(F)(F)F)n1 |
| InChI | InChI=1S/C25H32F6N6O3/c26-24(27,28)16-40-15-14-37(12-2-1-5-18-7-6-17-4-3-10-32-21(17)34-18)13-9-19(22(38)39)35-20-8-11-33-23(36-20)25(29,30)31/h6-8,11,19H,1-5,9-10,12-16H2,(H,32,34)(H,38,39)(H,33,35,36) |
| InChIKey | AFKCBJLWTLBNEI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.56 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|