C23H32F2N6O2 — CID 139463337
(2S)-4-[3,3-difluoropropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(pyrimidin-4-ylamino)butanoic acid (PubChem CID 139463337) has the molecular formula C23H32F2N6O2 and a molecular weight of 462.55 g/mol. Its IUPAC name is (2S)-4-[3,3-difluoropropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(pyrimidin-4-ylamino)butanoic acid.
| Compound Name | (2S)-4-[3,3-difluoropropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(pyrimidin-4-ylamino)butanoic acid |
|---|---|
| PubChem CID | 139463337 |
| Molecular Formula | C23H32F2N6O2 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | (2S)-4-[3,3-difluoropropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(pyrimidin-4-ylamino)butanoic acid |
| SMILES | O=C(O)[C@H](CCN(CCCCc1ccc2c(n1)NCCC2)CCC(F)F)Nc1ccncn1 |
| InChI | InChI=1S/C23H32F2N6O2/c24-20(25)10-15-31(14-9-19(23(32)33)30-21-8-12-26-16-28-21)13-2-1-5-18-7-6-17-4-3-11-27-22(17)29-18/h6-8,12,16,19-20H,1-5,9-11,13-15H2,(H,27,29)(H,32,33)(H,26,28,30)/t19-/m0/s1 |
| InChIKey | OQXNEDWHPXBBEP-IBGZPJMESA-N |
| XLogP | 3.46 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|