C24H31F2N7O2 — CID 139464260
2-[(3-cyanopyrazin-2-yl)amino]-4-[3,3-difluoropropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid (PubChem CID 139464260) has the molecular formula C24H31F2N7O2 and a molecular weight of 487.56 g/mol. Its IUPAC name is 2-[(3-cyanopyrazin-2-yl)amino]-4-[3,3-difluoropropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid.
| Compound Name | 2-[(3-cyanopyrazin-2-yl)amino]-4-[3,3-difluoropropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
|---|---|
| PubChem CID | 139464260 |
| Molecular Formula | C24H31F2N7O2 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | 2-[(3-cyanopyrazin-2-yl)amino]-4-[3,3-difluoropropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
| SMILES | N#Cc1nccnc1NC(CCN(CCCCc1ccc2c(n1)NCCC2)CCC(F)F)C(=O)O |
| InChI | InChI=1S/C24H31F2N7O2/c25-21(26)9-15-33(13-2-1-5-18-7-6-17-4-3-10-29-22(17)31-18)14-8-19(24(34)35)32-23-20(16-27)28-11-12-30-23/h6-7,11-12,19,21H,1-5,8-10,13-15H2,(H,29,31)(H,30,32)(H,34,35) |
| InChIKey | OYPVQOPSRPCWMV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 127.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|