C25H31F2N7O2 — CID 139463350
2-[(3-cyanopyrazin-2-yl)amino]-4-[(3,3-difluorocyclobutyl)-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid (PubChem CID 139463350) has the molecular formula C25H31F2N7O2 and a molecular weight of 499.57 g/mol. Its IUPAC name is 2-[(3-cyanopyrazin-2-yl)amino]-4-[(3,3-difluorocyclobutyl)-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid.
| Compound Name | 2-[(3-cyanopyrazin-2-yl)amino]-4-[(3,3-difluorocyclobutyl)-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
|---|---|
| PubChem CID | 139463350 |
| Molecular Formula | C25H31F2N7O2 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | 2-[(3-cyanopyrazin-2-yl)amino]-4-[(3,3-difluorocyclobutyl)-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
| SMILES | N#Cc1nccnc1NC(CCN(CCCCc1ccc2c(n1)NCCC2)C1CC(F)(F)C1)C(=O)O |
| InChI | InChI=1S/C25H31F2N7O2/c26-25(27)14-19(15-25)34(12-2-1-5-18-7-6-17-4-3-9-30-22(17)32-18)13-8-20(24(35)36)33-23-21(16-28)29-10-11-31-23/h6-7,10-11,19-20H,1-5,8-9,12-15H2,(H,30,32)(H,31,33)(H,35,36) |
| InChIKey | MKGHPWDNNOZKRT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 127.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|