C25H33N7O2 — CID 139464395
4-[cyclopropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)butanoic acid (PubChem CID 139464395) has the molecular formula C25H33N7O2 and a molecular weight of 463.59 g/mol. Its IUPAC name is 4-[cyclopropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)butanoic acid.
| Compound Name | 4-[cyclopropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)butanoic acid |
|---|---|
| PubChem CID | 139464395 |
| Molecular Formula | C25H33N7O2 |
| Molecular Weight | 463.59 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | 4-[cyclopropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)butanoic acid |
| SMILES | O=C(O)C(CCN(CCCCc1ccc2c(n1)NCCC2)C1CC1)Nc1ncnc2[nH]ccc12 |
| InChI | InChI=1S/C25H33N7O2/c33-25(34)21(31-24-20-10-13-27-23(20)28-16-29-24)11-15-32(19-8-9-19)14-2-1-5-18-7-6-17-4-3-12-26-22(17)30-18/h6-7,10,13,16,19,21H,1-5,8-9,11-12,14-15H2,(H,26,30)(H,33,34)(H2,27,28,29,31) |
| InChIKey | NXFQCJCCUUBWCN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 119.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.59 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|