C24H34N8O3 — CID 139463993
4-[2-methoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(1H-pyrazolo[5,4-d]pyrimidin-4-ylamino)butanoic acid (PubChem CID 139463993) has the molecular formula C24H34N8O3 and a molecular weight of 482.59 g/mol. Its IUPAC name is 4-[2-methoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(1H-pyrazolo[5,4-d]pyrimidin-4-ylamino)butanoic acid.
| Compound Name | 4-[2-methoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(1H-pyrazolo[5,4-d]pyrimidin-4-ylamino)butanoic acid |
|---|---|
| PubChem CID | 139463993 |
| Molecular Formula | C24H34N8O3 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.28 |
| IUPAC Name | 4-[2-methoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(1H-pyrazolo[5,4-d]pyrimidin-4-ylamino)butanoic acid |
| SMILES | COCCN(CCCCc1ccc2c(n1)NCCC2)CCC(Nc1ncnc2[nH]ncc12)C(=O)O |
| InChI | InChI=1S/C24H34N8O3/c1-35-14-13-32(11-3-2-6-18-8-7-17-5-4-10-25-21(17)29-18)12-9-20(24(33)34)30-22-19-15-28-31-23(19)27-16-26-22/h7-8,15-16,20H,2-6,9-14H2,1H3,(H,25,29)(H,33,34)(H2,26,27,28,30,31) |
| InChIKey | GNDJRJSUSYXHDR-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 141.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|