C26H35N7O3 — CID 169428843
(2S)-4-[2-methoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(pyrido[4,3-d]pyrimidin-4-ylamino)butanoic acid (PubChem CID 169428843) has the molecular formula C26H35N7O3 and a molecular weight of 493.61 g/mol. Its IUPAC name is (2S)-4-[2-methoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(pyrido[4,3-d]pyrimidin-4-ylamino)butanoic acid.
| Compound Name | (2S)-4-[2-methoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(pyrido[4,3-d]pyrimidin-4-ylamino)butanoic acid |
|---|---|
| PubChem CID | 169428843 |
| Molecular Formula | C26H35N7O3 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | (2S)-4-[2-methoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(pyrido[4,3-d]pyrimidin-4-ylamino)butanoic acid |
| SMILES | COCCN(CCCCc1ccc2c(n1)NCCC2)CC[C@H](Nc1ncnc2ccncc12)C(=O)O |
| InChI | InChI=1S/C26H35N7O3/c1-36-16-15-33(13-3-2-6-20-8-7-19-5-4-11-28-24(19)31-20)14-10-23(26(34)35)32-25-21-17-27-12-9-22(21)29-18-30-25/h7-9,12,17-18,23H,2-6,10-11,13-16H2,1H3,(H,28,31)(H,34,35)(H,29,30,32)/t23-/m0/s1 |
| InChIKey | KJDKWXHNGYDLGX-QHCPKHFHSA-N |
| XLogP | 3.00 |
| TPSA | 125.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|