C32H36F2N6O3 — CID 139463648
4-[2-(3,5-difluorophenoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(quinazolin-4-ylamino)butanoic acid (PubChem CID 139463648) has the molecular formula C32H36F2N6O3 and a molecular weight of 590.68 g/mol. Its IUPAC name is 4-[2-(3,5-difluorophenoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(quinazolin-4-ylamino)butanoic acid.
| Compound Name | 4-[2-(3,5-difluorophenoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(quinazolin-4-ylamino)butanoic acid |
|---|---|
| PubChem CID | 139463648 |
| Molecular Formula | C32H36F2N6O3 |
| Molecular Weight | 590.68 g/mol |
| Exact Mass | 590.28 |
| IUPAC Name | 4-[2-(3,5-difluorophenoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(quinazolin-4-ylamino)butanoic acid |
| SMILES | O=C(O)C(CCN(CCCCc1ccc2c(n1)NCCC2)CCOc1cc(F)cc(F)c1)Nc1ncnc2ccccc12 |
| InChI | InChI=1S/C32H36F2N6O3/c33-23-18-24(34)20-26(19-23)43-17-16-40(14-4-3-7-25-11-10-22-6-5-13-35-30(22)38-25)15-12-29(32(41)42)39-31-27-8-1-2-9-28(27)36-21-37-31/h1-2,8-11,18-21,29H,3-7,12-17H2,(H,35,38)(H,41,42)(H,36,37,39) |
| InChIKey | YWIXAKYDQQOJLI-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.68 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|