C38H56N6O9 — CID 178061913
4-[2-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]amino]-2-(quinazolin-4-ylamino)butanoic acid (PubChem CID 178061913) has the molecular formula C38H56N6O9 and a molecular weight of 740.90 g/mol. Its IUPAC name is 4-[2-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]amino]-2-(quinazolin-4-ylamino)butanoic acid.
| Compound Name | 4-[2-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]amino]-2-(quinazolin-4-ylamino)butanoic acid |
|---|---|
| PubChem CID | 178061913 |
| Molecular Formula | C38H56N6O9 |
| Molecular Weight | 740.90 g/mol |
| Exact Mass | 740.41 |
| IUPAC Name | 4-[2-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentyl]amino]-2-(quinazolin-4-ylamino)butanoic acid |
| SMILES | O=C(O)CCOCCOCCOCCOCCOCCN(CCCCCc1ccc2c(n1)NCCC2)CCC(Nc1ncnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C38H56N6O9/c45-35(46)14-19-49-21-23-51-25-27-53-28-26-52-24-22-50-20-18-44(16-5-1-2-8-31-12-11-30-7-6-15-39-36(30)42-31)17-13-34(38(47)48)43-37-32-9-3-4-10-33(32)40-29-41-37/h3-4,9-12,29,34H,1-2,5-8,13-28H2,(H,39,42)(H,45,46)(H,47,48)(H,40,41,43) |
| InChIKey | RVROSFDQWGINCS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 186.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.90 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|