C27H36N6O4 — CID 139463628
(2S)-4-[2,3-dihydroxypropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(quinazolin-4-ylamino)butanoic acid (PubChem CID 139463628) has the molecular formula C27H36N6O4 and a molecular weight of 508.62 g/mol. Its IUPAC name is (2S)-4-[2,3-dihydroxypropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(quinazolin-4-ylamino)butanoic acid.
| Compound Name | (2S)-4-[2,3-dihydroxypropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(quinazolin-4-ylamino)butanoic acid |
|---|---|
| PubChem CID | 139463628 |
| Molecular Formula | C27H36N6O4 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | (2S)-4-[2,3-dihydroxypropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(quinazolin-4-ylamino)butanoic acid |
| SMILES | O=C(O)[C@H](CCN(CCCCc1ccc2c(n1)NCCC2)CC(O)CO)Nc1ncnc2ccccc12 |
| InChI | InChI=1S/C27H36N6O4/c34-17-21(35)16-33(14-4-3-7-20-11-10-19-6-5-13-28-25(19)31-20)15-12-24(27(36)37)32-26-22-8-1-2-9-23(22)29-18-30-26/h1-2,8-11,18,21,24,34-35H,3-7,12-17H2,(H,28,31)(H,36,37)(H,29,30,32)/t21?,24-/m0/s1 |
| InChIKey | KYCUYDSHACZBSC-FHZUCYEKSA-N |
| XLogP | 2.32 |
| TPSA | 143.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|