C33H51N7O3 — CID 178061944
4-[(1-hydroxy-2-methylpropan-2-yl)-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(quinazolin-4-ylamino)butanoic acid;3-methylbutan-1-amine (PubChem CID 178061944) has the molecular formula C33H51N7O3 and a molecular weight of 593.82 g/mol. Its IUPAC name is 4-[(1-hydroxy-2-methylpropan-2-yl)-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(quinazolin-4-ylamino)butanoic acid;3-methylbutan-1-amine.
| Compound Name | 4-[(1-hydroxy-2-methylpropan-2-yl)-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(quinazolin-4-ylamino)butanoic acid;3-methylbutan-1-amine |
|---|---|
| PubChem CID | 178061944 |
| Molecular Formula | C33H51N7O3 |
| Molecular Weight | 593.82 g/mol |
| Exact Mass | 593.41 |
| IUPAC Name | 4-[(1-hydroxy-2-methylpropan-2-yl)-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(quinazolin-4-ylamino)butanoic acid;3-methylbutan-1-amine |
| SMILES | CC(C)(CO)N(CCCCc1ccc2c(n1)NCCC2)CCC(Nc1ncnc2ccccc12)C(=O)O.CC(C)CCN |
| InChI | InChI=1S/C28H38N6O3.C5H13N/c1-28(2,18-35)34(16-6-5-9-21-13-12-20-8-7-15-29-25(20)32-21)17-14-24(27(36)37)33-26-22-10-3-4-11-23(22)30-19-31-26;1-5(2)3-4-6/h3-4,10-13,19,24,35H,5-9,14-18H2,1-2H3,(H,29,32)(H,36,37)(H,30,31,33);5H,3-4,6H2,1-2H3 |
| InChIKey | ATPFAVCGMHXBIW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 149.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.82 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|