C29H39N7O3 — CID 139463884
(2S)-4-[morpholin-3-ylmethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(quinazolin-4-ylamino)butanoic acid (PubChem CID 139463884) has the molecular formula C29H39N7O3 and a molecular weight of 533.68 g/mol. Its IUPAC name is (2S)-4-[morpholin-3-ylmethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(quinazolin-4-ylamino)butanoic acid.
| Compound Name | (2S)-4-[morpholin-3-ylmethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(quinazolin-4-ylamino)butanoic acid |
|---|---|
| PubChem CID | 139463884 |
| Molecular Formula | C29H39N7O3 |
| Molecular Weight | 533.68 g/mol |
| Exact Mass | 533.31 |
| IUPAC Name | (2S)-4-[morpholin-3-ylmethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(quinazolin-4-ylamino)butanoic acid |
| SMILES | O=C(O)[C@H](CCN(CCCCc1ccc2c(n1)NCCC2)CC1COCCN1)Nc1ncnc2ccccc12 |
| InChI | InChI=1S/C29H39N7O3/c37-29(38)26(35-28-24-8-1-2-9-25(24)32-20-33-28)12-16-36(18-23-19-39-17-14-30-23)15-4-3-7-22-11-10-21-6-5-13-31-27(21)34-22/h1-2,8-11,20,23,26,30H,3-7,12-19H2,(H,31,34)(H,37,38)(H,32,33,35)/t23?,26-/m0/s1 |
| InChIKey | YJKMWXQGXDRQSC-NASUQTAISA-N |
| XLogP | 2.95 |
| TPSA | 124.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.68 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|