C27H34N6O2 — CID 139464240
(2S)-4-[cyclopropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(quinazolin-4-ylamino)butanoic acid (PubChem CID 139464240) has the molecular formula C27H34N6O2 and a molecular weight of 474.61 g/mol. Its IUPAC name is (2S)-4-[cyclopropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(quinazolin-4-ylamino)butanoic acid.
| Compound Name | (2S)-4-[cyclopropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(quinazolin-4-ylamino)butanoic acid |
|---|---|
| PubChem CID | 139464240 |
| Molecular Formula | C27H34N6O2 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | (2S)-4-[cyclopropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(quinazolin-4-ylamino)butanoic acid |
| SMILES | O=C(O)[C@H](CCN(CCCCc1ccc2c(n1)NCCC2)C1CC1)Nc1ncnc2ccccc12 |
| InChI | InChI=1S/C27H34N6O2/c34-27(35)24(32-26-22-8-1-2-9-23(22)29-18-30-26)14-17-33(21-12-13-21)16-4-3-7-20-11-10-19-6-5-15-28-25(19)31-20/h1-2,8-11,18,21,24H,3-7,12-17H2,(H,28,31)(H,34,35)(H,29,30,32)/t24-/m0/s1 |
| InChIKey | ZSMGYPDQBQVUFI-DEOSSOPVSA-N |
| XLogP | 4.13 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|