C23H32N6O2 — CID 139464199
4-[cyclopropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(pyrimidin-2-ylamino)butanoic acid (PubChem CID 139464199) has the molecular formula C23H32N6O2 and a molecular weight of 424.55 g/mol. Its IUPAC name is 4-[cyclopropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(pyrimidin-2-ylamino)butanoic acid.
| Compound Name | 4-[cyclopropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(pyrimidin-2-ylamino)butanoic acid |
|---|---|
| PubChem CID | 139464199 |
| Molecular Formula | C23H32N6O2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | 4-[cyclopropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(pyrimidin-2-ylamino)butanoic acid |
| SMILES | O=C(O)C(CCN(CCCCc1ccc2c(n1)NCCC2)C1CC1)Nc1ncccn1 |
| InChI | InChI=1S/C23H32N6O2/c30-22(31)20(28-23-25-13-4-14-26-23)11-16-29(19-9-10-19)15-2-1-6-18-8-7-17-5-3-12-24-21(17)27-18/h4,7-8,13-14,19-20H,1-3,5-6,9-12,15-16H2,(H,24,27)(H,30,31)(H,25,26,28) |
| InChIKey | WFYRRFITIJLDCP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|