C27H36N4O4 — CID 139464096
(2S)-4-[cyclopropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(phenylmethoxycarbonylamino)butanoic acid (PubChem CID 139464096) has the molecular formula C27H36N4O4 and a molecular weight of 480.61 g/mol. Its IUPAC name is (2S)-4-[cyclopropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(phenylmethoxycarbonylamino)butanoic acid.
| Compound Name | (2S)-4-[cyclopropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(phenylmethoxycarbonylamino)butanoic acid |
|---|---|
| PubChem CID | 139464096 |
| Molecular Formula | C27H36N4O4 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | (2S)-4-[cyclopropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(phenylmethoxycarbonylamino)butanoic acid |
| SMILES | O=C(N[C@@H](CCN(CCCCc1ccc2c(n1)NCCC2)C1CC1)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C27H36N4O4/c32-26(33)24(30-27(34)35-19-20-7-2-1-3-8-20)15-18-31(23-13-14-23)17-5-4-10-22-12-11-21-9-6-16-28-25(21)29-22/h1-3,7-8,11-12,23-24H,4-6,9-10,13-19H2,(H,28,29)(H,30,34)(H,32,33)/t24-/m0/s1 |
| InChIKey | MEAISWWPQBKPLR-DEOSSOPVSA-N |
| XLogP | 4.00 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|