C25H31FN4O5 — CID 146660672
2-[(3-fluorophenyl)methoxycarbonylamino]-4-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]butanoic acid (PubChem CID 146660672) has the molecular formula C25H31FN4O5 and a molecular weight of 486.54 g/mol. Its IUPAC name is 2-[(3-fluorophenyl)methoxycarbonylamino]-4-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]butanoic acid.
| Compound Name | 2-[(3-fluorophenyl)methoxycarbonylamino]-4-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]butanoic acid |
|---|---|
| PubChem CID | 146660672 |
| Molecular Formula | C25H31FN4O5 |
| Molecular Weight | 486.54 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | 2-[(3-fluorophenyl)methoxycarbonylamino]-4-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]butanoic acid |
| SMILES | O=C(CCCCc1ccc2c(n1)NCCC2)NCCC(NC(=O)OCc1cccc(F)c1)C(=O)O |
| InChI | InChI=1S/C25H31FN4O5/c26-19-7-3-5-17(15-19)16-35-25(34)30-21(24(32)33)12-14-27-22(31)9-2-1-8-20-11-10-18-6-4-13-28-23(18)29-20/h3,5,7,10-11,15,21H,1-2,4,6,8-9,12-14,16H2,(H,27,31)(H,28,29)(H,30,34)(H,32,33) |
| InChIKey | CKLZXEYHGVFGGE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 129.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.54 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|