C23H39N3O3 — CID 153402679
3,3-dimethyl-2-[2-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]ethyl]butanoic acid;ethane (PubChem CID 153402679) has the molecular formula C23H39N3O3 and a molecular weight of 405.58 g/mol. Its IUPAC name is 3,3-dimethyl-2-[2-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]ethyl]butanoic acid;ethane.
| Compound Name | 3,3-dimethyl-2-[2-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]ethyl]butanoic acid;ethane |
|---|---|
| PubChem CID | 153402679 |
| Molecular Formula | C23H39N3O3 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.30 |
| IUPAC Name | 3,3-dimethyl-2-[2-[5-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)pentanoylamino]ethyl]butanoic acid;ethane |
| SMILES | CC.CC(C)(C)C(CCNC(=O)CCCCc1ccc2c(n1)NCCC2)C(=O)O |
| InChI | InChI=1S/C21H33N3O3.C2H6/c1-21(2,3)17(20(26)27)12-14-22-18(25)9-5-4-8-16-11-10-15-7-6-13-23-19(15)24-16;1-2/h10-11,17H,4-9,12-14H2,1-3H3,(H,22,25)(H,23,24)(H,26,27);1-2H3 |
| InChIKey | AWFAAPNHYSQPML-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|