C23H36N2O2 — CID 163443467
N-(3-tert-butyl-4-hydroxypent-4-enyl)-5-(5,6,7,8-tetrahydroquinolin-2-yl)pentanamide (PubChem CID 163443467) has the molecular formula C23H36N2O2 and a molecular weight of 372.55 g/mol. Its IUPAC name is N-(3-tert-butyl-4-hydroxypent-4-enyl)-5-(5,6,7,8-tetrahydroquinolin-2-yl)pentanamide.
| Compound Name | N-(3-tert-butyl-4-hydroxypent-4-enyl)-5-(5,6,7,8-tetrahydroquinolin-2-yl)pentanamide |
|---|---|
| PubChem CID | 163443467 |
| Molecular Formula | C23H36N2O2 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.28 |
| IUPAC Name | N-(3-tert-butyl-4-hydroxypent-4-enyl)-5-(5,6,7,8-tetrahydroquinolin-2-yl)pentanamide |
| SMILES | C=C(O)C(CCNC(=O)CCCCc1ccc2c(n1)CCCC2)C(C)(C)C |
| InChI | InChI=1S/C23H36N2O2/c1-17(26)20(23(2,3)4)15-16-24-22(27)12-8-6-10-19-14-13-18-9-5-7-11-21(18)25-19/h13-14,20,26H,1,5-12,15-16H2,2-4H3,(H,24,27) |
| InChIKey | JIBBQRHRPGENTB-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|