C19H30N2O — CID 157367520
(3S)-3-amino-10-(5,6,7,8-tetrahydroquinolin-2-yl)decan-2-one (PubChem CID 157367520) has the molecular formula C19H30N2O and a molecular weight of 302.46 g/mol. Its IUPAC name is (3S)-3-amino-10-(5,6,7,8-tetrahydroquinolin-2-yl)decan-2-one.
| Compound Name | (3S)-3-amino-10-(5,6,7,8-tetrahydroquinolin-2-yl)decan-2-one |
|---|---|
| PubChem CID | 157367520 |
| Molecular Formula | C19H30N2O |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | (3S)-3-amino-10-(5,6,7,8-tetrahydroquinolin-2-yl)decan-2-one |
| SMILES | CC(=O)[C@@H](N)CCCCCCCc1ccc2c(n1)CCCC2 |
| InChI | InChI=1S/C19H30N2O/c1-15(22)18(20)11-6-4-2-3-5-10-17-14-13-16-9-7-8-12-19(16)21-17/h13-14,18H,2-12,20H2,1H3/t18-/m0/s1 |
| InChIKey | DFHOAQXYLAPVOR-SFHVURJKSA-N |
| XLogP | 3.76 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|