C27H41NO4 — CID 165032005
(2R)-2-[2-[(4S)-2,2-dimethyloxan-4-yl]-2-oxoethyl]-9-(5,6,7,8-tetrahydroquinolin-2-yl)nonanoic acid (PubChem CID 165032005) has the molecular formula C27H41NO4 and a molecular weight of 443.63 g/mol. Its IUPAC name is (2R)-2-[2-[(4S)-2,2-dimethyloxan-4-yl]-2-oxoethyl]-9-(5,6,7,8-tetrahydroquinolin-2-yl)nonanoic acid.
| Compound Name | (2R)-2-[2-[(4S)-2,2-dimethyloxan-4-yl]-2-oxoethyl]-9-(5,6,7,8-tetrahydroquinolin-2-yl)nonanoic acid |
|---|---|
| PubChem CID | 165032005 |
| Molecular Formula | C27H41NO4 |
| Molecular Weight | 443.63 g/mol |
| Exact Mass | 443.30 |
| IUPAC Name | (2R)-2-[2-[(4S)-2,2-dimethyloxan-4-yl]-2-oxoethyl]-9-(5,6,7,8-tetrahydroquinolin-2-yl)nonanoic acid |
| SMILES | CC1(C)C[C@@H](C(=O)C[C@@H](CCCCCCCc2ccc3c(n2)CCCC3)C(=O)O)CCO1 |
| InChI | InChI=1S/C27H41NO4/c1-27(2)19-22(16-17-32-27)25(29)18-21(26(30)31)11-6-4-3-5-7-12-23-15-14-20-10-8-9-13-24(20)28-23/h14-15,21-22H,3-13,16-19H2,1-2H3,(H,30,31)/t21-,22+/m1/s1 |
| InChIKey | LVHLDNIEVYMXCS-YADHBBJMSA-N |
| XLogP | 5.71 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.63 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|