C27H43N3O4 — CID 146483428
(2S)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)-2-[(2,2,6,6-tetramethyloxane-4-carbonyl)amino]nonanoic acid (PubChem CID 146483428) has the molecular formula C27H43N3O4 and a molecular weight of 473.66 g/mol. Its IUPAC name is (2S)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)-2-[(2,2,6,6-tetramethyloxane-4-carbonyl)amino]nonanoic acid.
| Compound Name | (2S)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)-2-[(2,2,6,6-tetramethyloxane-4-carbonyl)amino]nonanoic acid |
|---|---|
| PubChem CID | 146483428 |
| Molecular Formula | C27H43N3O4 |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 473.33 |
| IUPAC Name | (2S)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)-2-[(2,2,6,6-tetramethyloxane-4-carbonyl)amino]nonanoic acid |
| SMILES | CC1(C)CC(C(=O)N[C@@H](CCCCCCCc2ccc3c(n2)NCCC3)C(=O)O)CC(C)(C)O1 |
| InChI | InChI=1S/C27H43N3O4/c1-26(2)17-20(18-27(3,4)34-26)24(31)30-22(25(32)33)13-9-7-5-6-8-12-21-15-14-19-11-10-16-28-23(19)29-21/h14-15,20,22H,5-13,16-18H2,1-4H3,(H,28,29)(H,30,31)(H,32,33)/t22-/m0/s1 |
| InChIKey | WIVWSTWLBKFACK-QFIPXVFZSA-N |
| XLogP | 4.88 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|