C25H39N3O4 — CID 146483705
(2S)-2-[[(4R)-2,2-dimethyloxane-4-carbonyl]amino]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid (PubChem CID 146483705) has the molecular formula C25H39N3O4 and a molecular weight of 445.60 g/mol. Its IUPAC name is (2S)-2-[[(4R)-2,2-dimethyloxane-4-carbonyl]amino]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid.
| Compound Name | (2S)-2-[[(4R)-2,2-dimethyloxane-4-carbonyl]amino]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
|---|---|
| PubChem CID | 146483705 |
| Molecular Formula | C25H39N3O4 |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.29 |
| IUPAC Name | (2S)-2-[[(4R)-2,2-dimethyloxane-4-carbonyl]amino]-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
| SMILES | CC1(C)C[C@H](C(=O)N[C@@H](CCCCCCCc2ccc3c(n2)NCCC3)C(=O)O)CCO1 |
| InChI | InChI=1S/C25H39N3O4/c1-25(2)17-19(14-16-32-25)23(29)28-21(24(30)31)11-7-5-3-4-6-10-20-13-12-18-9-8-15-26-22(18)27-20/h12-13,19,21H,3-11,14-17H2,1-2H3,(H,26,27)(H,28,29)(H,30,31)/t19-,21+/m1/s1 |
| InChIKey | LPSHKOOZHUOKGR-CTNGQTDRSA-N |
| XLogP | 4.10 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|