C22H36N4O3 — CID 146483447
2-(diethylcarbamoylamino)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid (PubChem CID 146483447) has the molecular formula C22H36N4O3 and a molecular weight of 404.56 g/mol. Its IUPAC name is 2-(diethylcarbamoylamino)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid.
| Compound Name | 2-(diethylcarbamoylamino)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
|---|---|
| PubChem CID | 146483447 |
| Molecular Formula | C22H36N4O3 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | 2-(diethylcarbamoylamino)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
| SMILES | CCN(CC)C(=O)NC(CCCCCCCc1ccc2c(n1)NCCC2)C(=O)O |
| InChI | InChI=1S/C22H36N4O3/c1-3-26(4-2)22(29)25-19(21(27)28)13-9-7-5-6-8-12-18-15-14-17-11-10-16-23-20(17)24-18/h14-15,19H,3-13,16H2,1-2H3,(H,23,24)(H,25,29)(H,27,28) |
| InChIKey | QTJUCGJBZUQYLN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|