C24H39N3O4S — CID 18346108
(2S)-2-(cyclohexylmethylsulfonylamino)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid (PubChem CID 18346108) has the molecular formula C24H39N3O4S and a molecular weight of 465.66 g/mol. Its IUPAC name is (2S)-2-(cyclohexylmethylsulfonylamino)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid.
| Compound Name | (2S)-2-(cyclohexylmethylsulfonylamino)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
|---|---|
| PubChem CID | 18346108 |
| Molecular Formula | C24H39N3O4S |
| Molecular Weight | 465.66 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | (2S)-2-(cyclohexylmethylsulfonylamino)-9-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)nonanoic acid |
| SMILES | O=C(O)[C@H](CCCCCCCc1ccc2c(n1)NCCC2)NS(=O)(=O)CC1CCCCC1 |
| InChI | InChI=1S/C24H39N3O4S/c28-24(29)22(27-32(30,31)18-19-10-5-4-6-11-19)14-8-3-1-2-7-13-21-16-15-20-12-9-17-25-23(20)26-21/h15-16,19,22,27H,1-14,17-18H2,(H,25,26)(H,28,29)/t22-/m0/s1 |
| InChIKey | TUKHMWYVKVFEJD-QFIPXVFZSA-N |
| XLogP | 4.28 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.66 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|