C16H24N3O3Y- — CID 171833196
[1-carboxy-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]propyl]azanide;yttrium (PubChem CID 171833196) has the molecular formula C16H24N3O3Y- and a molecular weight of 395.29 g/mol. Its IUPAC name is [1-carboxy-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]propyl]azanide;yttrium.
| Compound Name | [1-carboxy-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]propyl]azanide;yttrium |
|---|---|
| PubChem CID | 171833196 |
| Molecular Formula | C16H24N3O3Y- |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | [1-carboxy-3-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]propyl]azanide;yttrium |
| SMILES | [NH-]C(CCOCCCCc1ccc2c(n1)NCCC2)C(=O)O.[Y] |
| InChI | InChI=1S/C16H24N3O3.Y/c17-14(16(20)21)8-11-22-10-2-1-5-13-7-6-12-4-3-9-18-15(12)19-13;/h6-7,14,17H,1-5,8-11H2,(H,18,19)(H,20,21);/q-1; |
| InChIKey | HOJBNBBXQMZIMN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 95.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|