C24H31N3O5 — CID 146462788
2-[[(2R)-2-hydroxy-2-phenylacetyl]amino]-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoic acid (PubChem CID 146462788) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is 2-[[(2R)-2-hydroxy-2-phenylacetyl]amino]-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoic acid.
| Compound Name | 2-[[(2R)-2-hydroxy-2-phenylacetyl]amino]-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoic acid |
|---|---|
| PubChem CID | 146462788 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | 2-[[(2R)-2-hydroxy-2-phenylacetyl]amino]-4-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butoxy]butanoic acid |
| SMILES | O=C(O)C(CCOCCCCc1ccc2c(n1)NCCC2)NC(=O)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C24H31N3O5/c28-21(17-7-2-1-3-8-17)23(29)27-20(24(30)31)13-16-32-15-5-4-10-19-12-11-18-9-6-14-25-22(18)26-19/h1-3,7-8,11-12,20-21,28H,4-6,9-10,13-16H2,(H,25,26)(H,27,29)(H,30,31)/t20?,21-/m1/s1 |
| InChIKey | LEPSDCHUBMLIMT-BPGUCPLFSA-N |
| XLogP | 2.47 |
| TPSA | 120.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|