C25H32N2O5 — CID 149465295
2-[[(2S)-2-hydroxy-2-phenylacetyl]amino]-4-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]butanoic acid (PubChem CID 149465295) has the molecular formula C25H32N2O5 and a molecular weight of 440.54 g/mol. Its IUPAC name is 2-[[(2S)-2-hydroxy-2-phenylacetyl]amino]-4-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]butanoic acid.
| Compound Name | 2-[[(2S)-2-hydroxy-2-phenylacetyl]amino]-4-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]butanoic acid |
|---|---|
| PubChem CID | 149465295 |
| Molecular Formula | C25H32N2O5 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | 2-[[(2S)-2-hydroxy-2-phenylacetyl]amino]-4-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]butanoic acid |
| SMILES | O=C(O)C(CCOCCCCc1ccc2c(n1)CCCC2)NC(=O)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C25H32N2O5/c28-23(19-9-2-1-3-10-19)24(29)27-22(25(30)31)15-17-32-16-7-6-11-20-14-13-18-8-4-5-12-21(18)26-20/h1-3,9-10,13-14,22-23,28H,4-8,11-12,15-17H2,(H,27,29)(H,30,31)/t22?,23-/m0/s1 |
| InChIKey | ZAHORRVRVZLIQU-WCSIJFPASA-N |
| XLogP | 2.99 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|