C26H31Cl2N3O4 — CID 161123403
2-[(2,6-dichlorobenzoyl)amino]-3-[3-[3-(5,6,7,8-tetrahydroquinolin-2-yl)propoxymethyl]azetidin-1-yl]propanoic acid (PubChem CID 161123403) has the molecular formula C26H31Cl2N3O4 and a molecular weight of 520.46 g/mol. Its IUPAC name is 2-[(2,6-dichlorobenzoyl)amino]-3-[3-[3-(5,6,7,8-tetrahydroquinolin-2-yl)propoxymethyl]azetidin-1-yl]propanoic acid.
| Compound Name | 2-[(2,6-dichlorobenzoyl)amino]-3-[3-[3-(5,6,7,8-tetrahydroquinolin-2-yl)propoxymethyl]azetidin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 161123403 |
| Molecular Formula | C26H31Cl2N3O4 |
| Molecular Weight | 520.46 g/mol |
| Exact Mass | 519.17 |
| IUPAC Name | 2-[(2,6-dichlorobenzoyl)amino]-3-[3-[3-(5,6,7,8-tetrahydroquinolin-2-yl)propoxymethyl]azetidin-1-yl]propanoic acid |
| SMILES | O=C(NC(CN1CC(COCCCc2ccc3c(n2)CCCC3)C1)C(=O)O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C26H31Cl2N3O4/c27-20-7-3-8-21(28)24(20)25(32)30-23(26(33)34)15-31-13-17(14-31)16-35-12-4-6-19-11-10-18-5-1-2-9-22(18)29-19/h3,7-8,10-11,17,23H,1-2,4-6,9,12-16H2,(H,30,32)(H,33,34) |
| InChIKey | ULFXVODLRFNQRL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|