C28H30N2O4 — CID 158673691
(2S)-2-benzamido-3-[4-[3-(5,6,7,8-tetrahydroquinolin-2-yl)propoxy]phenyl]propanoic acid (PubChem CID 158673691) has the molecular formula C28H30N2O4 and a molecular weight of 458.56 g/mol. Its IUPAC name is (2S)-2-benzamido-3-[4-[3-(5,6,7,8-tetrahydroquinolin-2-yl)propoxy]phenyl]propanoic acid.
| Compound Name | (2S)-2-benzamido-3-[4-[3-(5,6,7,8-tetrahydroquinolin-2-yl)propoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 158673691 |
| Molecular Formula | C28H30N2O4 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | (2S)-2-benzamido-3-[4-[3-(5,6,7,8-tetrahydroquinolin-2-yl)propoxy]phenyl]propanoic acid |
| SMILES | O=C(N[C@@H](Cc1ccc(OCCCc2ccc3c(n2)CCCC3)cc1)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C28H30N2O4/c31-27(22-8-2-1-3-9-22)30-26(28(32)33)19-20-12-16-24(17-13-20)34-18-6-10-23-15-14-21-7-4-5-11-25(21)29-23/h1-3,8-9,12-17,26H,4-7,10-11,18-19H2,(H,30,31)(H,32,33)/t26-/m0/s1 |
| InChIKey | SRDVRQTTYMQWMP-SANMLTNESA-N |
| XLogP | 4.40 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|