C24H27ClN4O4 — CID 70105562
2-benzamido-3-[4-[4-(pyrimidin-2-ylamino)butoxy]phenyl]propanoic acid;hydrochloride (PubChem CID 70105562) has the molecular formula C24H27ClN4O4 and a molecular weight of 470.96 g/mol. Its IUPAC name is 2-benzamido-3-[4-[4-(pyrimidin-2-ylamino)butoxy]phenyl]propanoic acid;hydrochloride.
| Compound Name | 2-benzamido-3-[4-[4-(pyrimidin-2-ylamino)butoxy]phenyl]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 70105562 |
| Molecular Formula | C24H27ClN4O4 |
| Molecular Weight | 470.96 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 2-benzamido-3-[4-[4-(pyrimidin-2-ylamino)butoxy]phenyl]propanoic acid;hydrochloride |
| SMILES | Cl.O=C(NC(Cc1ccc(OCCCCNc2ncccn2)cc1)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C24H26N4O4.ClH/c29-22(19-7-2-1-3-8-19)28-21(23(30)31)17-18-9-11-20(12-10-18)32-16-5-4-13-25-24-26-14-6-15-27-24;/h1-3,6-12,14-15,21H,4-5,13,16-17H2,(H,28,29)(H,30,31)(H,25,26,27);1H |
| InChIKey | SDBOWAPXQUTFSM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.96 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|