C34H30N2O6 — CID 66912848
(2S)-3-(4-phenylmethoxyphenyl)-2-[[4-(2-quinolin-8-yloxyethoxy)benzoyl]amino]propanoic acid (PubChem CID 66912848) has the molecular formula C34H30N2O6 and a molecular weight of 562.62 g/mol. Its IUPAC name is (2S)-3-(4-phenylmethoxyphenyl)-2-[[4-(2-quinolin-8-yloxyethoxy)benzoyl]amino]propanoic acid.
| Compound Name | (2S)-3-(4-phenylmethoxyphenyl)-2-[[4-(2-quinolin-8-yloxyethoxy)benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 66912848 |
| Molecular Formula | C34H30N2O6 |
| Molecular Weight | 562.62 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | (2S)-3-(4-phenylmethoxyphenyl)-2-[[4-(2-quinolin-8-yloxyethoxy)benzoyl]amino]propanoic acid |
| SMILES | O=C(N[C@@H](Cc1ccc(OCc2ccccc2)cc1)C(=O)O)c1ccc(OCCOc2cccc3cccnc23)cc1 |
| InChI | InChI=1S/C34H30N2O6/c37-33(36-30(34(38)39)22-24-11-15-29(16-12-24)42-23-25-6-2-1-3-7-25)27-13-17-28(18-14-27)40-20-21-41-31-10-4-8-26-9-5-19-35-32(26)31/h1-19,30H,20-23H2,(H,36,37)(H,38,39)/t30-/m0/s1 |
| InChIKey | VJOFYMZVORHTSA-PMERELPUSA-N |
| XLogP | 5.70 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.62 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|