C29H23N3O4 — CID 10116501
2-(quinoline-8-carbonylamino)-3-[4-(quinolin-2-ylmethoxy)phenyl]propanoic acid (PubChem CID 10116501) has the molecular formula C29H23N3O4 and a molecular weight of 477.52 g/mol. Its IUPAC name is 2-(quinoline-8-carbonylamino)-3-[4-(quinolin-2-ylmethoxy)phenyl]propanoic acid.
| Compound Name | 2-(quinoline-8-carbonylamino)-3-[4-(quinolin-2-ylmethoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 10116501 |
| Molecular Formula | C29H23N3O4 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 2-(quinoline-8-carbonylamino)-3-[4-(quinolin-2-ylmethoxy)phenyl]propanoic acid |
| SMILES | O=C(NC(Cc1ccc(OCc2ccc3ccccc3n2)cc1)C(=O)O)c1cccc2cccnc12 |
| InChI | InChI=1S/C29H23N3O4/c33-28(24-8-3-6-21-7-4-16-30-27(21)24)32-26(29(34)35)17-19-10-14-23(15-11-19)36-18-22-13-12-20-5-1-2-9-25(20)31-22/h1-16,26H,17-18H2,(H,32,33)(H,34,35) |
| InChIKey | YBCNEBVDKNXZAA-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |