C25H25NO6 — CID 54452131
(2S)-2-[(2,6-dimethoxybenzoyl)amino]-3-(4-phenylmethoxyphenyl)propanoic acid (PubChem CID 54452131) has the molecular formula C25H25NO6 and a molecular weight of 435.48 g/mol. Its IUPAC name is (2S)-2-[(2,6-dimethoxybenzoyl)amino]-3-(4-phenylmethoxyphenyl)propanoic acid.
| Compound Name | (2S)-2-[(2,6-dimethoxybenzoyl)amino]-3-(4-phenylmethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 54452131 |
| Molecular Formula | C25H25NO6 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | (2S)-2-[(2,6-dimethoxybenzoyl)amino]-3-(4-phenylmethoxyphenyl)propanoic acid |
| SMILES | COc1cccc(OC)c1C(=O)N[C@@H](Cc1ccc(OCc2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C25H25NO6/c1-30-21-9-6-10-22(31-2)23(21)24(27)26-20(25(28)29)15-17-11-13-19(14-12-17)32-16-18-7-4-3-5-8-18/h3-14,20H,15-16H2,1-2H3,(H,26,27)(H,28,29)/t20-/m0/s1 |
| InChIKey | WVQWXLKWYGUOOK-FQEVSTJZSA-N |
| XLogP | 3.71 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |