C33H27NO4 — CID 58677474
2-[(6-phenylmethoxynaphthalene-2-carbonyl)amino]-3-(4-phenylphenyl)propanoic acid (PubChem CID 58677474) has the molecular formula C33H27NO4 and a molecular weight of 501.58 g/mol. Its IUPAC name is 2-[(6-phenylmethoxynaphthalene-2-carbonyl)amino]-3-(4-phenylphenyl)propanoic acid.
| Compound Name | 2-[(6-phenylmethoxynaphthalene-2-carbonyl)amino]-3-(4-phenylphenyl)propanoic acid |
|---|---|
| PubChem CID | 58677474 |
| Molecular Formula | C33H27NO4 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | 2-[(6-phenylmethoxynaphthalene-2-carbonyl)amino]-3-(4-phenylphenyl)propanoic acid |
| SMILES | O=C(NC(Cc1ccc(-c2ccccc2)cc1)C(=O)O)c1ccc2cc(OCc3ccccc3)ccc2c1 |
| InChI | InChI=1S/C33H27NO4/c35-32(34-31(33(36)37)19-23-11-13-26(14-12-23)25-9-5-2-6-10-25)29-16-15-28-21-30(18-17-27(28)20-29)38-22-24-7-3-1-4-8-24/h1-18,20-21,31H,19,22H2,(H,34,35)(H,36,37) |
| InChIKey | HUXRBLQKSPHBHU-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |